2-Tert-Butyl-4-methoxyphenol
Common Name: |
2-Tert-Butyl-4-methoxyphenol |
IUPAC Name: |
2-tert-butyl-4-methoxyphenol |
Molecular Formula: |
C11H16O2 |
SMILES: |
CC(C)(C)C1=C(C=CC(=C1)OC)O |
Inchi: |
1S/C11H16O2/c1-11(2,3)9-7-8(13-4)5-6-10(9)12/h5-7,12H,1-4H3 |
Inchi Key: |
MRBKEAMVRSLQPH-UHFFFAOYSA-N |
Cas No: |
25013-16-5 |
Name |
Value |
Lipinski Violations |
0 |
Ghose Violations |
0 |
Veber Violations |
0 |
Egan Violations |
0 |
Muegge Violations |
1 |
Name |
Value |
Molecular Weight (g/mol) |
180.24 |
Mass (g/mol) |
180.115 |
Molar Refractivity |
54.23 |
Net Charge |
|
HBD |
1 |
HBA |
2 |
Rt Bonds |
2 |
Rings |
1 |
TPSA |
29.46 |
Hetero Atoms |
2 |
Heavy Atoms |
13 |
Aromatic Heavy Atoms |
6 |
Melting Point (°C) |
58.00 to 60.00 |
Boiling Point (°C@760.00mm Hg) |
268.00 to 269.00 |
Vapor Pressure (mmHg@25.00 °C) |
0.004 |
Vapor Density (Air =1) |
6.2 |
Fraction Csp3 |
0.45 |
LogP |
2.698 |
iLOGP |
2.55 |
XLOGP3 |
3.15 |
WLOGP |
2.70 |
MLOGP |
2.39 |
ESOL Log S |
-3.15 |
ESOL Solubility (mg/ml) |
0.127 |
ESOL Solubility (mol/l) |
0.001 |
ESOL Class: esol_class |
Soluble |
Ali Log S |
-3.44 |
Ali Solubility (mg/ml) |
0.07 |
Ali Solubility (mol/l) |
0 |
Ali Class |
Soluble |
Silicos-IT LogSw |
-3.16 |
Silicos-IT Solubility (mg/ml) |
0.13 |
Silicos-IT Solubility (mol/l) |
0 |
Silicos-IT Class |
Soluble |
Name |
Value |
GI Absorption |
High |
BBB Permeable |
1 |
PgP Substrate |
0 |
Log Kp (cm/s) |
-5.16 |
Bioavailability Score |
0.55 |
Caco2 |
1 |
Human Intestinal Absorption |
1 |
Plasm Protein Binding |
0.952 |
CYP1A2 Inhibitor |
1 |
CYP2C19 Inhibitor |
0 |
CYP2C9 Inhibitor |
0 |
CYP2D6 inhibitor |
0 |
CYP3A4 inhibitor |
0 |
Ames mutagenesis |
0 |
Acute Oral Toxicity |
1.914 |
Carcinogenicity (Binary) |
0 |
Carcinogenicity (Trinary) |
Non-required |
Eye Irritation |
1 |
Hepatotoxicity |
0 |
Androgen Receptor Binding |
1 |
Aromatase Binding |
0 |
Estrogen Receptor Binding |
0 |
Glucocorticoid Receptor Binding |
0 |
Thyroid Receptor Binding |
0 |
BRCP inhibitor |
0 |
BSEP inhibitor |
0 |
OATP1B1 inhibitor |
1 |
OATP1B3 inhibitor |
1 |
OATP2B1 inhibitor |
0 |
OCT1 inhibitor |
0 |
OCT2 inhibitor |
0 |