4-Formyl-2-methoxyphenyl acetate
| Common Name: |
4-Formyl-2-methoxyphenyl acetate |
| IUPAC Name: |
(4-formyl-2-methoxyphenyl) acetate |
| Molecular Formula: |
C10H10O4 |
| SMILES: |
CC(=O)OC1=C(C=C(C=C1)C=O)OC |
| Inchi: |
1S/C10H10O4/c1-7(12)14-9-4-3-8(6-11)5-10(9)13-2/h3-6H,1-2H3 |
| Inchi Key: |
PZSJOBKRSVRODF-UHFFFAOYSA-N |
| Cas No: |
881-68-5 |
| Name |
Value |
| Lipinski Violations |
0 |
| Ghose Violations |
0 |
| Veber Violations |
0 |
| Egan Violations |
0 |
| Muegge Violations |
1 |
| Name |
Value |
| Molecular Weight (g/mol) |
194.18 |
| Mass (g/mol) |
194.058 |
| Molar Refractivity |
49.82 |
| Net Charge |
|
| HBD |
|
| HBA |
4 |
| Rt Bonds |
4 |
| Rings |
1 |
| TPSA |
52.60 |
| Hetero Atoms |
4 |
| Heavy Atoms |
14 |
| Aromatic Heavy Atoms |
6 |
| Melting Point (°C) |
77.00 to 79.00 |
| Boiling Point (°C@760.00mm Hg) |
287.00 to 288.00 |
| Vapor Pressure (mmHg@25.00 °C) |
0.002 |
| Vapor Density (Air =1) |
|
| Fraction Csp3 |
0.20 |
| LogP |
1.433 |
| iLOGP |
1.92 |
| XLOGP3 |
1.00 |
| WLOGP |
1.43 |
| MLOGP |
1.00 |
| ESOL Log S |
-1.73 |
| ESOL Solubility (mg/ml) |
3.64 |
| ESOL Solubility (mol/l) |
0.019 |
| ESOL Class: esol_class |
Very soluble |
| Ali Log S |
-1.69 |
| Ali Solubility (mg/ml) |
3.93 |
| Ali Solubility (mol/l) |
0.02 |
| Ali Class |
Very soluble |
| Silicos-IT LogSw |
-2.55 |
| Silicos-IT Solubility (mg/ml) |
0.54 |
| Silicos-IT Solubility (mol/l) |
0 |
| Silicos-IT Class |
Soluble |
| Name |
Value |
| GI Absorption |
High |
| BBB Permeable |
1 |
| PgP Substrate |
0 |
| Log Kp (cm/s) |
-6.77 |
| Bioavailability Score |
0.55 |
| Caco2 |
1 |
| Human Intestinal Absorption |
1 |
| Plasm Protein Binding |
0.595 |
| CYP1A2 Inhibitor |
1 |
| CYP2C19 Inhibitor |
0 |
| CYP2C9 Inhibitor |
0 |
| CYP2D6 inhibitor |
0 |
| CYP3A4 inhibitor |
0 |
| Ames mutagenesis |
0 |
| Acute Oral Toxicity |
1.975 |
| Carcinogenicity (Binary) |
0 |
| Carcinogenicity (Trinary) |
Non-required |
| Eye Irritation |
1 |
| Hepatotoxicity |
1 |
| Androgen Receptor Binding |
0 |
| Aromatase Binding |
0 |
| Estrogen Receptor Binding |
0 |
| Glucocorticoid Receptor Binding |
0 |
| Thyroid Receptor Binding |
0 |
| BRCP inhibitor |
0 |
| BSEP inhibitor |
0 |
| OATP1B1 inhibitor |
1 |
| OATP1B3 inhibitor |
1 |
| OATP2B1 inhibitor |
0 |
| OCT1 inhibitor |
0 |
| OCT2 inhibitor |
0 |
